C23H24FN3O6 — CID 90436374
(2S)-2-[[4-[2-[4-(1,2-dihydroxyethyl)-3-fluorophenyl]ethynyl]benzoyl]-methylamino]-N-hydroxy-N',2-dimethylpropanediamide (PubChem CID 90436374) has the molecular formula C23H24FN3O6 and a molecular weight of 457.46 g/mol. Its IUPAC name is (2S)-2-[[4-[2-[4-(1,2-dihydroxyethyl)-3-fluorophenyl]ethynyl]benzoyl]-methylamino]-N-hydroxy-N',2-dimethylpropanediamide.
| Compound Name | (2S)-2-[[4-[2-[4-(1,2-dihydroxyethyl)-3-fluorophenyl]ethynyl]benzoyl]-methylamino]-N-hydroxy-N',2-dimethylpropanediamide |
|---|---|
| PubChem CID | 90436374 |
| Molecular Formula | C23H24FN3O6 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (2S)-2-[[4-[2-[4-(1,2-dihydroxyethyl)-3-fluorophenyl]ethynyl]benzoyl]-methylamino]-N-hydroxy-N',2-dimethylpropanediamide |
| SMILES | CNC(=O)[C@@](C)(C(=O)NO)N(C)C(=O)c1ccc(C#Cc2ccc(C(O)CO)c(F)c2)cc1 |
| InChI | InChI=1S/C23H24FN3O6/c1-23(21(31)25-2,22(32)26-33)27(3)20(30)16-9-6-14(7-10-16)4-5-15-8-11-17(18(24)12-15)19(29)13-28/h6-12,19,28-29,33H,13H2,1-3H3,(H,25,31)(H,26,32)/t19?,23-/m0/s1 |
| InChIKey | JATOAKMBYNINOC-BVHINDKJSA-N |
| XLogP | 0.33 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|