C29H35N3O7 — CID 138613312
2-[[4-[2-[4-(1,3-dihydroxypropan-2-yl)phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide (PubChem CID 138613312) has the molecular formula C29H35N3O7 and a molecular weight of 537.61 g/mol. Its IUPAC name is 2-[[4-[2-[4-(1,3-dihydroxypropan-2-yl)phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide.
| Compound Name | 2-[[4-[2-[4-(1,3-dihydroxypropan-2-yl)phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
|---|---|
| PubChem CID | 138613312 |
| Molecular Formula | C29H35N3O7 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 2-[[4-[2-[4-(1,3-dihydroxypropan-2-yl)phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
| SMILES | CNC(=O)C(C)(C(=O)NOC1CCCCO1)N(C)C(=O)c1ccc(C#Cc2ccc(C(CO)CO)cc2)cc1 |
| InChI | InChI=1S/C29H35N3O7/c1-29(27(36)30-2,28(37)31-39-25-6-4-5-17-38-25)32(3)26(35)23-15-11-21(12-16-23)8-7-20-9-13-22(14-10-20)24(18-33)19-34/h9-16,24-25,33-34H,4-6,17-19H2,1-3H3,(H,30,36)(H,31,37) |
| InChIKey | ZBVRYNSPSHBDKV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|