C36H49N3O8 — CID 138613486
2-[[hydroxy-[4-[2-[4-[[2-methyl-2-(oxan-2-yloxy)propoxy]methyl]phenyl]ethynyl]phenyl]methyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide (PubChem CID 138613486) has the molecular formula C36H49N3O8 and a molecular weight of 651.80 g/mol. Its IUPAC name is 2-[[hydroxy-[4-[2-[4-[[2-methyl-2-(oxan-2-yloxy)propoxy]methyl]phenyl]ethynyl]phenyl]methyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide.
| Compound Name | 2-[[hydroxy-[4-[2-[4-[[2-methyl-2-(oxan-2-yloxy)propoxy]methyl]phenyl]ethynyl]phenyl]methyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
|---|---|
| PubChem CID | 138613486 |
| Molecular Formula | C36H49N3O8 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.35 |
| IUPAC Name | 2-[[hydroxy-[4-[2-[4-[[2-methyl-2-(oxan-2-yloxy)propoxy]methyl]phenyl]ethynyl]phenyl]methyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
| SMILES | CNC(=O)C(C)(C(=O)NOC1CCCCO1)N(C)C(O)c1ccc(C#Cc2ccc(COCC(C)(C)OC3CCCCO3)cc2)cc1 |
| InChI | InChI=1S/C36H49N3O8/c1-35(2,46-30-10-6-8-22-44-30)25-43-24-28-16-14-26(15-17-28)12-13-27-18-20-29(21-19-27)32(40)39(5)36(3,33(41)37-4)34(42)38-47-31-11-7-9-23-45-31/h14-21,30-32,40H,6-11,22-25H2,1-5H3,(H,37,41)(H,38,42) |
| InChIKey | BCUGUIWXKYXJBN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|