C36H46N2O7 — CID 162136580
N-methyl-N-[(2R)-2-methyl-1-(methylamino)-4-(oxan-2-yloxy)-1,3-dioxobutan-2-yl]-4-[2-[4-[(1R)-1-(oxan-2-yloxy)butyl]phenyl]ethynyl]benzamide (PubChem CID 162136580) has the molecular formula C36H46N2O7 and a molecular weight of 618.77 g/mol. Its IUPAC name is N-methyl-N-[(2R)-2-methyl-1-(methylamino)-4-(oxan-2-yloxy)-1,3-dioxobutan-2-yl]-4-[2-[4-[(1R)-1-(oxan-2-yloxy)butyl]phenyl]ethynyl]benzamide.
| Compound Name | N-methyl-N-[(2R)-2-methyl-1-(methylamino)-4-(oxan-2-yloxy)-1,3-dioxobutan-2-yl]-4-[2-[4-[(1R)-1-(oxan-2-yloxy)butyl]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 162136580 |
| Molecular Formula | C36H46N2O7 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | N-methyl-N-[(2R)-2-methyl-1-(methylamino)-4-(oxan-2-yloxy)-1,3-dioxobutan-2-yl]-4-[2-[4-[(1R)-1-(oxan-2-yloxy)butyl]phenyl]ethynyl]benzamide |
| SMILES | CCC[C@@H](OC1CCCCO1)c1ccc(C#Cc2ccc(C(=O)N(C)[C@](C)(C(=O)COC3CCCCO3)C(=O)NC)cc2)cc1 |
| InChI | InChI=1S/C36H46N2O7/c1-5-10-30(45-33-12-7-9-24-43-33)28-19-15-26(16-20-28)13-14-27-17-21-29(22-18-27)34(40)38(4)36(2,35(41)37-3)31(39)25-44-32-11-6-8-23-42-32/h15-22,30,32-33H,5-12,23-25H2,1-4H3,(H,37,41)/t30-,32?,33?,36-/m1/s1 |
| InChIKey | BVURDCOETIPRNS-KKNYBAKOSA-N |
| XLogP | 5.16 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|