C33H45N3O7 — CID 145376913
ethane;(2S)-2-[[4-[2-[4-[2-(2-hydroxypropan-2-yloxy)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide (PubChem CID 145376913) has the molecular formula C33H45N3O7 and a molecular weight of 595.74 g/mol. Its IUPAC name is ethane;(2S)-2-[[4-[2-[4-[2-(2-hydroxypropan-2-yloxy)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide.
| Compound Name | ethane;(2S)-2-[[4-[2-[4-[2-(2-hydroxypropan-2-yloxy)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
|---|---|
| PubChem CID | 145376913 |
| Molecular Formula | C33H45N3O7 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | ethane;(2S)-2-[[4-[2-[4-[2-(2-hydroxypropan-2-yloxy)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
| SMILES | CC.CNC(=O)[C@@](C)(C(=O)NOC1CCCCO1)N(C)C(=O)c1ccc(C#Cc2ccc(CCOC(C)(C)O)cc2)cc1 |
| InChI | InChI=1S/C31H39N3O7.C2H6/c1-30(2,38)40-21-19-24-13-11-22(12-14-24)9-10-23-15-17-25(18-16-23)27(35)34(5)31(3,28(36)32-4)29(37)33-41-26-8-6-7-20-39-26;1-2/h11-18,26,38H,6-8,19-21H2,1-5H3,(H,32,36)(H,33,37);1-2H3/t26?,31-;/m0./s1 |
| InChIKey | LAMHZCQFEHLSRP-KUOQGLPESA-N |
| XLogP | 3.55 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|