C32H40N4O6 — CID 89413278
N,2-dimethyl-2-[methyl-[4-[2-[4-(1,4-oxazepan-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide (PubChem CID 89413278) has the molecular formula C32H40N4O6 and a molecular weight of 576.69 g/mol. Its IUPAC name is N,2-dimethyl-2-[methyl-[4-[2-[4-(1,4-oxazepan-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide.
| Compound Name | N,2-dimethyl-2-[methyl-[4-[2-[4-(1,4-oxazepan-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide |
|---|---|
| PubChem CID | 89413278 |
| Molecular Formula | C32H40N4O6 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | N,2-dimethyl-2-[methyl-[4-[2-[4-(1,4-oxazepan-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide |
| SMILES | CNC(=O)C(C)(C(=O)NOC1CCCCO1)N(C)C(=O)c1ccc(C#Cc2ccc(CN3CCCOCC3)cc2)cc1 |
| InChI | InChI=1S/C32H40N4O6/c1-32(30(38)33-2,31(39)34-42-28-7-4-5-21-41-28)35(3)29(37)27-16-14-25(15-17-27)9-8-24-10-12-26(13-11-24)23-36-18-6-20-40-22-19-36/h10-17,28H,4-7,18-23H2,1-3H3,(H,33,38)(H,34,39) |
| InChIKey | FCNBUIOGQUFEJO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|