C27H33N5O5 — CID 71273080
methyl 3-[amino(methyl)amino]-2-[amino-[4-[2-[4-(1,4-oxazepan-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]-2-methyl-3-oxopropanoate (PubChem CID 71273080) has the molecular formula C27H33N5O5 and a molecular weight of 507.59 g/mol. Its IUPAC name is methyl 3-[amino(methyl)amino]-2-[amino-[4-[2-[4-(1,4-oxazepan-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]-2-methyl-3-oxopropanoate.
| Compound Name | methyl 3-[amino(methyl)amino]-2-[amino-[4-[2-[4-(1,4-oxazepan-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 71273080 |
| Molecular Formula | C27H33N5O5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | methyl 3-[amino(methyl)amino]-2-[amino-[4-[2-[4-(1,4-oxazepan-4-ylmethyl)phenyl]ethynyl]benzoyl]amino]-2-methyl-3-oxopropanoate |
| SMILES | COC(=O)C(C)(C(=O)N(C)N)N(N)C(=O)c1ccc(C#Cc2ccc(CN3CCCOCC3)cc2)cc1 |
| InChI | InChI=1S/C27H33N5O5/c1-27(26(35)36-3,25(34)30(2)28)32(29)24(33)23-13-11-21(12-14-23)6-5-20-7-9-22(10-8-20)19-31-15-4-17-37-18-16-31/h7-14H,4,15-19,28-29H2,1-3H3 |
| InChIKey | OFTNUENISATBTP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 131.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|