C26H35N3O6 — CID 138613456
(2S)-2-[[4-[(Z)-3-hydroxy-3-methylhept-4-en-1-ynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide (PubChem CID 138613456) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is (2S)-2-[[4-[(Z)-3-hydroxy-3-methylhept-4-en-1-ynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide.
| Compound Name | (2S)-2-[[4-[(Z)-3-hydroxy-3-methylhept-4-en-1-ynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
|---|---|
| PubChem CID | 138613456 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (2S)-2-[[4-[(Z)-3-hydroxy-3-methylhept-4-en-1-ynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
| SMILES | CC/C=C\C(C)(O)C#Cc1ccc(C(=O)N(C)[C@@](C)(C(=O)NC)C(=O)NOC2CCCCO2)cc1 |
| InChI | InChI=1S/C26H35N3O6/c1-6-7-16-25(2,33)17-15-19-11-13-20(14-12-19)22(30)29(5)26(3,23(31)27-4)24(32)28-35-21-10-8-9-18-34-21/h7,11-14,16,21,33H,6,8-10,18H2,1-5H3,(H,27,31)(H,28,32)/b16-7-/t21?,25?,26-/m0/s1 |
| InChIKey | DNLDQZODRCGIOW-WDPOYLEJSA-N |
| XLogP | 1.91 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|