C30H39FN4O6 — CID 89448033
(2S)-2-[[4-[4-[[3-(2-fluoroethoxy)azetidin-1-yl]methyl]phenyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide (PubChem CID 89448033) has the molecular formula C30H39FN4O6 and a molecular weight of 570.66 g/mol. Its IUPAC name is (2S)-2-[[4-[4-[[3-(2-fluoroethoxy)azetidin-1-yl]methyl]phenyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide.
| Compound Name | (2S)-2-[[4-[4-[[3-(2-fluoroethoxy)azetidin-1-yl]methyl]phenyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
|---|---|
| PubChem CID | 89448033 |
| Molecular Formula | C30H39FN4O6 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | (2S)-2-[[4-[4-[[3-(2-fluoroethoxy)azetidin-1-yl]methyl]phenyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
| SMILES | CNC(=O)[C@@](C)(C(=O)NOC1CCCCO1)N(C)C(=O)c1ccc(-c2ccc(CN3CC(OCCF)C3)cc2)cc1 |
| InChI | InChI=1S/C30H39FN4O6/c1-30(28(37)32-2,29(38)33-41-26-6-4-5-16-40-26)34(3)27(36)24-13-11-23(12-14-24)22-9-7-21(8-10-22)18-35-19-25(20-35)39-17-15-31/h7-14,25-26H,4-6,15-20H2,1-3H3,(H,32,37)(H,33,38)/t26?,30-/m0/s1 |
| InChIKey | KERICQULNSADEF-WSXWNZDHSA-N |
| XLogP | 2.67 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|