C32H41N3O6 — CID 157108739
N-methyl-N-[(2R)-2-methyl-1-(methylamino)-4-(oxan-2-yloxy)-1,3-dioxobutan-2-yl]-4-[(E)-2-[4-(morpholin-4-ylmethyl)phenyl]ethenyl]benzamide (PubChem CID 157108739) has the molecular formula C32H41N3O6 and a molecular weight of 563.70 g/mol. Its IUPAC name is N-methyl-N-[(2R)-2-methyl-1-(methylamino)-4-(oxan-2-yloxy)-1,3-dioxobutan-2-yl]-4-[(E)-2-[4-(morpholin-4-ylmethyl)phenyl]ethenyl]benzamide.
| Compound Name | N-methyl-N-[(2R)-2-methyl-1-(methylamino)-4-(oxan-2-yloxy)-1,3-dioxobutan-2-yl]-4-[(E)-2-[4-(morpholin-4-ylmethyl)phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 157108739 |
| Molecular Formula | C32H41N3O6 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | N-methyl-N-[(2R)-2-methyl-1-(methylamino)-4-(oxan-2-yloxy)-1,3-dioxobutan-2-yl]-4-[(E)-2-[4-(morpholin-4-ylmethyl)phenyl]ethenyl]benzamide |
| SMILES | CNC(=O)[C@@](C)(C(=O)COC1CCCCO1)N(C)C(=O)c1ccc(/C=C/c2ccc(CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C32H41N3O6/c1-32(31(38)33-2,28(36)23-41-29-6-4-5-19-40-29)34(3)30(37)27-15-13-25(14-16-27)8-7-24-9-11-26(12-10-24)22-35-17-20-39-21-18-35/h7-16,29H,4-6,17-23H2,1-3H3,(H,33,38)/b8-7+/t29?,32-/m1/s1 |
| InChIKey | JJXCYELDJUFTAE-FMBKFGNUSA-N |
| XLogP | 3.38 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|