C25H29N3O6 — CID 152885356
N-[(2R)-4-hydroxy-2-methyl-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[2-[5-(morpholin-4-ylmethyl)furan-3-yl]ethynyl]benzamide (PubChem CID 152885356) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is N-[(2R)-4-hydroxy-2-methyl-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[2-[5-(morpholin-4-ylmethyl)furan-3-yl]ethynyl]benzamide.
| Compound Name | N-[(2R)-4-hydroxy-2-methyl-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[2-[5-(morpholin-4-ylmethyl)furan-3-yl]ethynyl]benzamide |
|---|---|
| PubChem CID | 152885356 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[(2R)-4-hydroxy-2-methyl-1-(methylamino)-1,3-dioxobutan-2-yl]-N-methyl-4-[2-[5-(morpholin-4-ylmethyl)furan-3-yl]ethynyl]benzamide |
| SMILES | CNC(=O)[C@@](C)(C(=O)CO)N(C)C(=O)c1ccc(C#Cc2coc(CN3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C25H29N3O6/c1-25(22(30)16-29,24(32)26-2)27(3)23(31)20-8-6-18(7-9-20)4-5-19-14-21(34-17-19)15-28-10-12-33-13-11-28/h6-9,14,17,29H,10-13,15-16H2,1-3H3,(H,26,32)/t25-/m1/s1 |
| InChIKey | UCHDBBFRZCEQLP-RUZDIDTESA-N |
| XLogP | 0.65 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|