C35H45N3O8 — CID 90436050
(2S)-N,2-dimethyl-2-[methyl-[4-[2-[4-[2-[2-(oxan-2-yloxy)ethoxy]ethyl]phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide (PubChem CID 90436050) has the molecular formula C35H45N3O8 and a molecular weight of 635.76 g/mol. Its IUPAC name is (2S)-N,2-dimethyl-2-[methyl-[4-[2-[4-[2-[2-(oxan-2-yloxy)ethoxy]ethyl]phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide.
| Compound Name | (2S)-N,2-dimethyl-2-[methyl-[4-[2-[4-[2-[2-(oxan-2-yloxy)ethoxy]ethyl]phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide |
|---|---|
| PubChem CID | 90436050 |
| Molecular Formula | C35H45N3O8 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.32 |
| IUPAC Name | (2S)-N,2-dimethyl-2-[methyl-[4-[2-[4-[2-[2-(oxan-2-yloxy)ethoxy]ethyl]phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide |
| SMILES | CNC(=O)[C@@](C)(C(=O)NOC1CCCCO1)N(C)C(=O)c1ccc(C#Cc2ccc(CCOCCOC3CCCCO3)cc2)cc1 |
| InChI | InChI=1S/C35H45N3O8/c1-35(33(40)36-2,34(41)37-46-31-9-5-7-22-44-31)38(3)32(39)29-18-16-27(17-19-29)11-10-26-12-14-28(15-13-26)20-23-42-24-25-45-30-8-4-6-21-43-30/h12-19,30-31H,4-9,20-25H2,1-3H3,(H,36,40)(H,37,41)/t30?,31?,35-/m0/s1 |
| InChIKey | IQJSQGUSQFHAPH-HRRPHCOOSA-N |
| XLogP | 3.34 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|