C29H35N3O7 — CID 138613447
2-[[4-[2-[4-(2-hydroxy-1-methoxyethyl)phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide (PubChem CID 138613447) has the molecular formula C29H35N3O7 and a molecular weight of 537.61 g/mol. Its IUPAC name is 2-[[4-[2-[4-(2-hydroxy-1-methoxyethyl)phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide.
| Compound Name | 2-[[4-[2-[4-(2-hydroxy-1-methoxyethyl)phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
|---|---|
| PubChem CID | 138613447 |
| Molecular Formula | C29H35N3O7 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 2-[[4-[2-[4-(2-hydroxy-1-methoxyethyl)phenyl]ethynyl]benzoyl]-methylamino]-N,2-dimethyl-N'-(oxan-2-yloxy)propanediamide |
| SMILES | CNC(=O)C(C)(C(=O)NOC1CCCCO1)N(C)C(=O)c1ccc(C#Cc2ccc(C(CO)OC)cc2)cc1 |
| InChI | InChI=1S/C29H35N3O7/c1-29(27(35)30-2,28(36)31-39-25-7-5-6-18-38-25)32(3)26(34)23-16-12-21(13-17-23)9-8-20-10-14-22(15-11-20)24(19-33)37-4/h10-17,24-25,33H,5-7,18-19H2,1-4H3,(H,30,35)(H,31,36) |
| InChIKey | QNOSACCUVGVVCS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|