C33H41N3O8 — CID 137497710
(2S)-2-[[4-[2-[4-[(1S)-2-methoxy-1-(oxan-2-yloxy)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N-methyl-N'-(oxan-2-yloxy)propanediamide (PubChem CID 137497710) has the molecular formula C33H41N3O8 and a molecular weight of 607.70 g/mol. Its IUPAC name is (2S)-2-[[4-[2-[4-[(1S)-2-methoxy-1-(oxan-2-yloxy)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N-methyl-N'-(oxan-2-yloxy)propanediamide.
| Compound Name | (2S)-2-[[4-[2-[4-[(1S)-2-methoxy-1-(oxan-2-yloxy)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N-methyl-N'-(oxan-2-yloxy)propanediamide |
|---|---|
| PubChem CID | 137497710 |
| Molecular Formula | C33H41N3O8 |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | (2S)-2-[[4-[2-[4-[(1S)-2-methoxy-1-(oxan-2-yloxy)ethyl]phenyl]ethynyl]benzoyl]-methylamino]-N-methyl-N'-(oxan-2-yloxy)propanediamide |
| SMILES | CNC(=O)[C@@H](C(=O)NOC1CCCCO1)N(C)C(=O)c1ccc(C#Cc2ccc([C@@H](COC)OC3CCCCO3)cc2)cc1 |
| InChI | InChI=1S/C33H41N3O8/c1-34-31(37)30(32(38)35-44-29-9-5-7-21-42-29)36(2)33(39)26-18-14-24(15-19-26)11-10-23-12-16-25(17-13-23)27(22-40-3)43-28-8-4-6-20-41-28/h12-19,27-30H,4-9,20-22H2,1-3H3,(H,34,37)(H,35,38)/t27-,28?,29?,30+/m1/s1 |
| InChIKey | PMCNMVSCDGJSGA-ZRSAMKBMSA-N |
| XLogP | 3.08 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|