C41H55N3O10 — CID 118885092
(2S)-N,2-dimethyl-2-[methyl-[4-[2-[4-[1-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)propoxy]ethyl]phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide (PubChem CID 118885092) has the molecular formula C41H55N3O10 and a molecular weight of 749.90 g/mol. Its IUPAC name is (2S)-N,2-dimethyl-2-[methyl-[4-[2-[4-[1-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)propoxy]ethyl]phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide.
| Compound Name | (2S)-N,2-dimethyl-2-[methyl-[4-[2-[4-[1-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)propoxy]ethyl]phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide |
|---|---|
| PubChem CID | 118885092 |
| Molecular Formula | C41H55N3O10 |
| Molecular Weight | 749.90 g/mol |
| Exact Mass | 749.39 |
| IUPAC Name | (2S)-N,2-dimethyl-2-[methyl-[4-[2-[4-[1-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)propoxy]ethyl]phenyl]ethynyl]benzoyl]amino]-N'-(oxan-2-yloxy)propanediamide |
| SMILES | CNC(=O)[C@@](C)(C(=O)NOC1CCCCO1)N(C)C(=O)c1ccc(C#Cc2ccc(C(COCCCOC3CCCCO3)OC3CCCCO3)cc2)cc1 |
| InChI | InChI=1S/C41H55N3O10/c1-41(39(46)42-2,40(47)43-54-37-13-6-9-27-52-37)44(3)38(45)33-22-18-31(19-23-33)15-14-30-16-20-32(21-17-30)34(53-36-12-5-8-26-51-36)29-48-24-10-28-50-35-11-4-7-25-49-35/h16-23,34-37H,4-13,24-29H2,1-3H3,(H,42,46)(H,43,47)/t34?,35?,36?,37?,41-/m0/s1 |
| InChIKey | NNWTYRYBXJNRQU-TVTJBVKUSA-N |
| XLogP | 4.77 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|