C31H41N3O7 — CID 163671429
(2S)-N-hydroxy-2-[[hydroxy-[4-[2-[4-[[2-methyl-2-(oxan-2-yloxy)propoxy]methyl]phenyl]ethynyl]phenyl]methyl]-methylamino]-N',2-dimethylpropanediamide (PubChem CID 163671429) has the molecular formula C31H41N3O7 and a molecular weight of 567.68 g/mol. Its IUPAC name is (2S)-N-hydroxy-2-[[hydroxy-[4-[2-[4-[[2-methyl-2-(oxan-2-yloxy)propoxy]methyl]phenyl]ethynyl]phenyl]methyl]-methylamino]-N',2-dimethylpropanediamide.
| Compound Name | (2S)-N-hydroxy-2-[[hydroxy-[4-[2-[4-[[2-methyl-2-(oxan-2-yloxy)propoxy]methyl]phenyl]ethynyl]phenyl]methyl]-methylamino]-N',2-dimethylpropanediamide |
|---|---|
| PubChem CID | 163671429 |
| Molecular Formula | C31H41N3O7 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | (2S)-N-hydroxy-2-[[hydroxy-[4-[2-[4-[[2-methyl-2-(oxan-2-yloxy)propoxy]methyl]phenyl]ethynyl]phenyl]methyl]-methylamino]-N',2-dimethylpropanediamide |
| SMILES | CNC(=O)[C@@](C)(C(=O)NO)N(C)C(O)c1ccc(C#Cc2ccc(COCC(C)(C)OC3CCCCO3)cc2)cc1 |
| InChI | InChI=1S/C31H41N3O7/c1-30(2,41-26-8-6-7-19-40-26)21-39-20-24-13-11-22(12-14-24)9-10-23-15-17-25(18-16-23)27(35)34(5)31(3,28(36)32-4)29(37)33-38/h11-18,26-27,35,38H,6-8,19-21H2,1-5H3,(H,32,36)(H,33,37)/t26?,27?,31-/m0/s1 |
| InChIKey | JCXJHFRZWQZPRY-OXVIYWBMSA-N |
| XLogP | 2.86 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|