C20H21FN7O7PS — CID 118674197
2-[[[(2S,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 118674197) has the molecular formula C20H21FN7O7PS and a molecular weight of 553.47 g/mol. Its IUPAC name is 2-[[[(2S,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | 2-[[[(2S,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 118674197 |
| Molecular Formula | C20H21FN7O7PS |
| Molecular Weight | 553.47 g/mol |
| Exact Mass | 553.09 |
| IUPAC Name | 2-[[[(2S,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2-azido-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | CC(NP(=O)(OC[C@]1(N=[N+]=[N-])O[C@@H](c2csc3c(N)ncnc23)[C@H](F)[C@@H]1O)Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H21FN7O7PS/c1-10(19(30)31)26-36(32,35-11-5-3-2-4-6-11)33-8-20(27-28-23)17(29)13(21)15(34-20)12-7-37-16-14(12)24-9-25-18(16)22/h2-7,9-10,13,15,17,29H,8H2,1H3,(H,26,32)(H,30,31)(H2,22,24,25)/t10?,13-,15-,17-,20-,36?/m0/s1 |
| InChIKey | OZOSBFHBTZLMDA-ZHYJPPLZSA-N |
| XLogP | 3.32 |
| TPSA | 214.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|