C12H10F3N3O3 — CID 118678592
1-[(4-methoxyphenyl)methyl]-4-nitro-3-(trifluoromethyl)pyrazole (PubChem CID 118678592) has the molecular formula C12H10F3N3O3 and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-4-nitro-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-4-nitro-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 118678592 |
| Molecular Formula | C12H10F3N3O3 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-4-nitro-3-(trifluoromethyl)pyrazole |
| SMILES | COc1ccc(Cn2cc([N+](=O)[O-])c(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C12H10F3N3O3/c1-21-9-4-2-8(3-5-9)6-17-7-10(18(19)20)11(16-17)12(13,14)15/h2-5,7H,6H2,1H3 |
| InChIKey | OZUFPSLERHRGJM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|