C14H9F6N3O3 — CID 58370523
2,2,2-trifluoro-1-[1-[(3-methyl-4-nitrophenyl)methyl]-3-(trifluoromethyl)pyrazol-4-yl]ethanone (PubChem CID 58370523) has the molecular formula C14H9F6N3O3 and a molecular weight of 381.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-[(3-methyl-4-nitrophenyl)methyl]-3-(trifluoromethyl)pyrazol-4-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[1-[(3-methyl-4-nitrophenyl)methyl]-3-(trifluoromethyl)pyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 58370523 |
| Molecular Formula | C14H9F6N3O3 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-[(3-methyl-4-nitrophenyl)methyl]-3-(trifluoromethyl)pyrazol-4-yl]ethanone |
| SMILES | Cc1cc(Cn2cc(C(=O)C(F)(F)F)c(C(F)(F)F)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9F6N3O3/c1-7-4-8(2-3-10(7)23(25)26)5-22-6-9(12(24)14(18,19)20)11(21-22)13(15,16)17/h2-4,6H,5H2,1H3 |
| InChIKey | MBKPGXLMKRKXJD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|