C15H11F8N3O2 — CID 86617139
1-[(3-methyl-4-nitrophenyl)methyl]-4-(1,1,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)pyrazole (PubChem CID 86617139) has the molecular formula C15H11F8N3O2 and a molecular weight of 417.26 g/mol. Its IUPAC name is 1-[(3-methyl-4-nitrophenyl)methyl]-4-(1,1,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-[(3-methyl-4-nitrophenyl)methyl]-4-(1,1,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 86617139 |
| Molecular Formula | C15H11F8N3O2 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 1-[(3-methyl-4-nitrophenyl)methyl]-4-(1,1,3,3,3-pentafluoropropyl)-3-(trifluoromethyl)pyrazole |
| SMILES | Cc1cc(Cn2cc(C(F)(F)CC(F)(F)F)c(C(F)(F)F)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11F8N3O2/c1-8-4-9(2-3-11(8)26(27)28)5-25-6-10(12(24-25)15(21,22)23)13(16,17)7-14(18,19)20/h2-4,6H,5,7H2,1H3 |
| InChIKey | KDSFNSNGBSJWRH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|