C14H9F8N3O2S — CID 86656135
1-[(3-methyl-4-nitrophenyl)methyl]-3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethylsulfanyl)pyrazole (PubChem CID 86656135) has the molecular formula C14H9F8N3O2S and a molecular weight of 435.30 g/mol. Its IUPAC name is 1-[(3-methyl-4-nitrophenyl)methyl]-3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethylsulfanyl)pyrazole.
| Compound Name | 1-[(3-methyl-4-nitrophenyl)methyl]-3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethylsulfanyl)pyrazole |
|---|---|
| PubChem CID | 86656135 |
| Molecular Formula | C14H9F8N3O2S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 1-[(3-methyl-4-nitrophenyl)methyl]-3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethylsulfanyl)pyrazole |
| SMILES | Cc1cc(Cn2nc(C(F)(F)C(F)(F)F)cc2SC(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9F8N3O2S/c1-7-4-8(2-3-9(7)25(26)27)6-24-11(28-14(20,21)22)5-10(23-24)12(15,16)13(17,18)19/h2-5H,6H2,1H3 |
| InChIKey | MSTRREPQAIHIFS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|