C13H10F6N4O2 — CID 87299242
5-[(3-methyl-4-nitrophenyl)methyl]-1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)-1,2,4-triazole (PubChem CID 87299242) has the molecular formula C13H10F6N4O2 and a molecular weight of 368.24 g/mol. Its IUPAC name is 5-[(3-methyl-4-nitrophenyl)methyl]-1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 5-[(3-methyl-4-nitrophenyl)methyl]-1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 87299242 |
| Molecular Formula | C13H10F6N4O2 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 5-[(3-methyl-4-nitrophenyl)methyl]-1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)-1,2,4-triazole |
| SMILES | Cc1cc(Cc2nc(C(F)(F)F)nn2CC(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10F6N4O2/c1-7-4-8(2-3-9(7)23(24)25)5-10-20-11(13(17,18)19)21-22(10)6-12(14,15)16/h2-4H,5-6H2,1H3 |
| InChIKey | JYVDGYXJSUEVNJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|