C10H6F6N4O2S — CID 57425807
1-[(5-methyl-4-nitrothiophen-2-yl)methyl]-3,5-bis(trifluoromethyl)-1,2,4-triazole (PubChem CID 57425807) has the molecular formula C10H6F6N4O2S and a molecular weight of 360.24 g/mol. Its IUPAC name is 1-[(5-methyl-4-nitrothiophen-2-yl)methyl]-3,5-bis(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 1-[(5-methyl-4-nitrothiophen-2-yl)methyl]-3,5-bis(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 57425807 |
| Molecular Formula | C10H6F6N4O2S |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 1-[(5-methyl-4-nitrothiophen-2-yl)methyl]-3,5-bis(trifluoromethyl)-1,2,4-triazole |
| SMILES | Cc1sc(Cn2nc(C(F)(F)F)nc2C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H6F6N4O2S/c1-4-6(20(21)22)2-5(23-4)3-19-8(10(14,15)16)17-7(18-19)9(11,12)13/h2H,3H2,1H3 |
| InChIKey | IVTNMCYRQCBDCB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|