C6HF3N5NaO3 — CID 5196794
sodium 6-nitro-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-4-id-7-one (PubChem CID 5196794) has the molecular formula C6HF3N5NaO3 and a molecular weight of 271.09 g/mol. Its IUPAC name is sodium 6-nitro-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-4-id-7-one.
| Compound Name | sodium 6-nitro-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-4-id-7-one |
|---|---|
| PubChem CID | 5196794 |
| Molecular Formula | C6HF3N5NaO3 |
| Molecular Weight | 271.09 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | sodium 6-nitro-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-4-id-7-one |
| SMILES | O=c1c([N+](=O)[O-])c[n-]c2nc(C(F)(F)F)nn12.[Na+] |
| InChI | InChI=1S/C6H2F3N5O3.Na/c7-6(8,9)4-11-5-10-1-2(14(16)17)3(15)13(5)12-4;/h1H,(H,10,11,12,15);/q;+1/p-1 |
| InChIKey | XDPUNCSIKLPRQD-UHFFFAOYSA-M |
| XLogP | -3.02 |
| TPSA | 104.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.09 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|