C14H14F3N3O3 — CID 155948034
ethyl 1-[(1-methyl-2-oxo-4-pyridinyl)methyl]-3-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 155948034) has the molecular formula C14H14F3N3O3 and a molecular weight of 329.28 g/mol. Its IUPAC name is ethyl 1-[(1-methyl-2-oxo-4-pyridinyl)methyl]-3-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[(1-methyl-2-oxo-4-pyridinyl)methyl]-3-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 155948034 |
| Molecular Formula | C14H14F3N3O3 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | ethyl 1-[(1-methyl-2-oxo-4-pyridinyl)methyl]-3-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2ccn(C)c(=O)c2)nc1C(F)(F)F |
| InChI | InChI=1S/C14H14F3N3O3/c1-3-23-13(22)10-8-20(18-12(10)14(15,16)17)7-9-4-5-19(2)11(21)6-9/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | ZBPYWFXTZCISRG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |