C16H26O3 — CID 118678983
8-[4-(methoxymethylidene)cyclohexyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 118678983) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 8-[4-(methoxymethylidene)cyclohexyl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-[4-(methoxymethylidene)cyclohexyl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 118678983 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 8-[4-(methoxymethylidene)cyclohexyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | COC=C1CCC(C2CCC3(CC2)OCCO3)CC1 |
| InChI | InChI=1S/C16H26O3/c1-17-12-13-2-4-14(5-3-13)15-6-8-16(9-7-15)18-10-11-19-16/h12,14-15H,2-11H2,1H3/b13-12- |
| InChIKey | QDVGJXVIDCVOCD-SEYXRHQNSA-N |
| XLogP | 3.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|