C17H26O4 — CID 154967058
(2'E,4'aS,8'aS)-2'-(methoxymethylidene)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydro-3H-naphthalene]-1'-one (PubChem CID 154967058) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2'E,4'aS,8'aS)-2'-(methoxymethylidene)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydro-3H-naphthalene]-1'-one.
| Compound Name | (2'E,4'aS,8'aS)-2'-(methoxymethylidene)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydro-3H-naphthalene]-1'-one |
|---|---|
| PubChem CID | 154967058 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (2'E,4'aS,8'aS)-2'-(methoxymethylidene)-5',5',8'a-trimethylspiro[1,3-dioxolane-2,6'-4,4a,7,8-tetrahydro-3H-naphthalene]-1'-one |
| SMILES | CO/C=C1\CC[C@H]2C(C)(C)C3(CC[C@]2(C)C1=O)OCCO3 |
| InChI | InChI=1S/C17H26O4/c1-15(2)13-6-5-12(11-19-4)14(18)16(13,3)7-8-17(15)20-9-10-21-17/h11,13H,5-10H2,1-4H3/b12-11+/t13-,16-/m0/s1 |
| InChIKey | RQDLORJVTKWMSA-XPMIASGBSA-N |
| XLogP | 3.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|