C20H32O3 — CID 163818160
(5aR,9aS,9bR)-3a,6,6,9a-tetramethylspiro[1,2,4,5,5a,8,9,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxane]-3-one (PubChem CID 163818160) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (5aR,9aS,9bR)-3a,6,6,9a-tetramethylspiro[1,2,4,5,5a,8,9,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxane]-3-one.
| Compound Name | (5aR,9aS,9bR)-3a,6,6,9a-tetramethylspiro[1,2,4,5,5a,8,9,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxane]-3-one |
|---|---|
| PubChem CID | 163818160 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (5aR,9aS,9bR)-3a,6,6,9a-tetramethylspiro[1,2,4,5,5a,8,9,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxane]-3-one |
| SMILES | CC12CC[C@H]3C(C)(C)C4(CC[C@]3(C)[C@H]1CCC2=O)OCCCO4 |
| InChI | InChI=1S/C20H32O3/c1-17(2)14-8-9-19(4)15(6-7-16(19)21)18(14,3)10-11-20(17)22-12-5-13-23-20/h14-15H,5-13H2,1-4H3/t14-,15+,18-,19?/m0/s1 |
| InChIKey | NTCLEDWTSLOHAD-QILHDJAHSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |