C22H33ClO2 — CID 89257763
(4bS,10aR)-10a-[(E)-3-chloroprop-1-enyl]-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane] (PubChem CID 89257763) has the molecular formula C22H33ClO2 and a molecular weight of 364.96 g/mol. Its IUPAC name is (4bS,10aR)-10a-[(E)-3-chloroprop-1-enyl]-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane].
| Compound Name | (4bS,10aR)-10a-[(E)-3-chloroprop-1-enyl]-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 89257763 |
| Molecular Formula | C22H33ClO2 |
| Molecular Weight | 364.96 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (4bS,10aR)-10a-[(E)-3-chloroprop-1-enyl]-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane] |
| SMILES | CC1(C)C2CC[C@@]3(/C=C/CCl)CCCC=C3[C@@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C22H33ClO2/c1-19(2)17-8-11-21(10-6-14-23)9-5-4-7-18(21)20(17,3)12-13-22(19)24-15-16-25-22/h6-7,10,17H,4-5,8-9,11-16H2,1-3H3/b10-6+/t17?,20-,21-/m0/s1 |
| InChIKey | HCUSAAQPDKJNEV-XNYMVYKASA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.96 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|