C24H37NO2 — CID 163452798
3-[(4'aS)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,6,7,8,9,10,10a-octahydrophenanthrene]-8'a-yl]-N,N-dimethylprop-2-yn-1-amine (PubChem CID 163452798) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is 3-[(4'aS)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,6,7,8,9,10,10a-octahydrophenanthrene]-8'a-yl]-N,N-dimethylprop-2-yn-1-amine.
| Compound Name | 3-[(4'aS)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,6,7,8,9,10,10a-octahydrophenanthrene]-8'a-yl]-N,N-dimethylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 163452798 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | 3-[(4'aS)-1',1',4'a-trimethylspiro[1,3-dioxolane-2,2'-3,4,6,7,8,9,10,10a-octahydrophenanthrene]-8'a-yl]-N,N-dimethylprop-2-yn-1-amine |
| SMILES | CN(C)CC#CC12CCCC=C1[C@@]1(C)CCC3(OCCO3)C(C)(C)C1CC2 |
| InChI | InChI=1S/C24H37NO2/c1-21(2)19-10-13-23(12-8-16-25(4)5)11-7-6-9-20(23)22(19,3)14-15-24(21)26-17-18-27-24/h9,19H,6-7,10-11,13-18H2,1-5H3/t19?,22-,23?/m0/s1 |
| InChIKey | BHYWYLLEHHOOIA-UTCTYZAISA-N |
| XLogP | 4.63 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|