C20H28AcO4 — CID 58802165
actinium;(4'bS,8'aR,9'S,10'aS)-9'-hydroxy-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-6,8a,9,10-tetrahydro-5H-phenanthrene]-3'-one (PubChem CID 58802165) has the molecular formula C20H28AcO4 and a molecular weight of 559.44 g/mol. Its IUPAC name is actinium;(4'bS,8'aR,9'S,10'aS)-9'-hydroxy-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-6,8a,9,10-tetrahydro-5H-phenanthrene]-3'-one.
| Compound Name | actinium;(4'bS,8'aR,9'S,10'aS)-9'-hydroxy-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-6,8a,9,10-tetrahydro-5H-phenanthrene]-3'-one |
|---|---|
| PubChem CID | 58802165 |
| Molecular Formula | C20H28AcO4 |
| Molecular Weight | 559.44 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | actinium;(4'bS,8'aR,9'S,10'aS)-9'-hydroxy-4'b,8',8',10'a-tetramethylspiro[1,3-dioxolane-2,7'-6,8a,9,10-tetrahydro-5H-phenanthrene]-3'-one |
| SMILES | CC1(C)[C@@H]2[C@@H](O)C[C@@]3(C)C=CC(=O)C=C3[C@@]2(C)CCC12OCCO2.[Ac] |
| InChI | InChI=1S/C20H28O4.Ac/c1-17(2)16-14(22)12-18(3)6-5-13(21)11-15(18)19(16,4)7-8-20(17)23-9-10-24-20;/h5-6,11,14,16,22H,7-10,12H2,1-4H3;/t14-,16-,18+,19+;/m0./s1 |
| InChIKey | ULMBOEDTGXQJSR-ILFIDANNSA-N |
| XLogP | 3.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |