C26H26N2O3 — CID 118680056
9H-fluoren-9-ylmethyl (6R,8aS)-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate (PubChem CID 118680056) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (6R,8aS)-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (6R,8aS)-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate |
|---|---|
| PubChem CID | 118680056 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (6R,8aS)-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1CCC[C@]12C=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C26H26N2O3/c29-24-26(14-12-18-7-5-15-27(18)24)13-6-16-28(26)25(30)31-17-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-4,8-12,14,18,23H,5-7,13,15-17H2/t18-,26+/m0/s1 |
| InChIKey | QYPSWZSYTITDHO-HFJWLAOPSA-N |
| XLogP | 4.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|