C29H31NO5S — CID 155632693
9H-fluoren-9-ylmethyl 2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate (PubChem CID 155632693) has the molecular formula C29H31NO5S and a molecular weight of 505.64 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155632693 |
| Molecular Formula | C29H31NO5S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCCN(C(=O)OCC3c4ccccc4-c4ccccc43)C2(C)C)cc1 |
| InChI | InChI=1S/C29H31NO5S/c1-20-14-16-21(17-15-20)36(32,33)35-27-13-8-18-30(29(27,2)3)28(31)34-19-26-24-11-6-4-9-22(24)23-10-5-7-12-25(23)26/h4-7,9-12,14-17,26-27H,8,13,18-19H2,1-3H3 |
| InChIKey | LPLNDTTZPDMAKC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|