C20H34N2 — CID 118683629
1-[(4-tert-butylphenyl)methyl]-N,N-diethylpiperidin-4-amine (PubChem CID 118683629) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-N,N-diethylpiperidin-4-amine.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-N,N-diethylpiperidin-4-amine |
|---|---|
| PubChem CID | 118683629 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-N,N-diethylpiperidin-4-amine |
| SMILES | CCN(CC)C1CCN(Cc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H34N2/c1-6-22(7-2)19-12-14-21(15-13-19)16-17-8-10-18(11-9-17)20(3,4)5/h8-11,19H,6-7,12-16H2,1-5H3 |
| InChIKey | NRFMZWYDGZBPDI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |