C17H27NO8S — CID 118685239
(Z)-5-[2,5-dioxo-1-(2-sulfooxyethyl)pyrrolidin-3-yl]undec-6-enoic acid (PubChem CID 118685239) has the molecular formula C17H27NO8S and a molecular weight of 405.47 g/mol. Its IUPAC name is (Z)-5-[2,5-dioxo-1-(2-sulfooxyethyl)pyrrolidin-3-yl]undec-6-enoic acid.
| Compound Name | (Z)-5-[2,5-dioxo-1-(2-sulfooxyethyl)pyrrolidin-3-yl]undec-6-enoic acid |
|---|---|
| PubChem CID | 118685239 |
| Molecular Formula | C17H27NO8S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (Z)-5-[2,5-dioxo-1-(2-sulfooxyethyl)pyrrolidin-3-yl]undec-6-enoic acid |
| SMILES | CCCC/C=C\C(CCCC(=O)O)C1CC(=O)N(CCOS(=O)(=O)O)C1=O |
| InChI | InChI=1S/C17H27NO8S/c1-2-3-4-5-7-13(8-6-9-16(20)21)14-12-15(19)18(17(14)22)10-11-26-27(23,24)25/h5,7,13-14H,2-4,6,8-12H2,1H3,(H,20,21)(H,23,24,25)/b7-5- |
| InChIKey | JDJRYWRDECLSFE-ALCCZGGFSA-N |
| XLogP | 1.80 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|