C8H12O3 — CID 118688797
6-methyl-2-propan-2-yl-1,3-dioxin-4-one (PubChem CID 118688797) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 6-methyl-2-propan-2-yl-1,3-dioxin-4-one.
| Compound Name | 6-methyl-2-propan-2-yl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 118688797 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 6-methyl-2-propan-2-yl-1,3-dioxin-4-one |
| SMILES | CC1=CC(=O)OC(C(C)C)O1 |
| InChI | InChI=1S/C8H12O3/c1-5(2)8-10-6(3)4-7(9)11-8/h4-5,8H,1-3H3 |
| InChIKey | GTKIYIQYDXZPPD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |