C25H32O3S — CID 118689526
3-cyclohexylpentan-3-yl 2-(3-phenylsulfanylphenoxy)acetate (PubChem CID 118689526) has the molecular formula C25H32O3S and a molecular weight of 412.60 g/mol. Its IUPAC name is 3-cyclohexylpentan-3-yl 2-(3-phenylsulfanylphenoxy)acetate.
| Compound Name | 3-cyclohexylpentan-3-yl 2-(3-phenylsulfanylphenoxy)acetate |
|---|---|
| PubChem CID | 118689526 |
| Molecular Formula | C25H32O3S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3-cyclohexylpentan-3-yl 2-(3-phenylsulfanylphenoxy)acetate |
| SMILES | CCC(CC)(OC(=O)COc1cccc(Sc2ccccc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C25H32O3S/c1-3-25(4-2,20-12-7-5-8-13-20)28-24(26)19-27-21-14-11-17-23(18-21)29-22-15-9-6-10-16-22/h6,9-11,14-18,20H,3-5,7-8,12-13,19H2,1-2H3 |
| InChIKey | XXSWZDASJCYOIT-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |