C33H33F3N4O4 — CID 118692178
tert-butyl 4-[5-cyano-2-[3-methyl-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazolin-4-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 118692178) has the molecular formula C33H33F3N4O4 and a molecular weight of 606.65 g/mol. Its IUPAC name is tert-butyl 4-[5-cyano-2-[3-methyl-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazolin-4-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-cyano-2-[3-methyl-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazolin-4-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 118692178 |
| Molecular Formula | C33H33F3N4O4 |
| Molecular Weight | 606.65 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | tert-butyl 4-[5-cyano-2-[3-methyl-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazolin-4-yl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CN1C(=O)N(c2cccc(C(F)(F)F)c2)C2=C(C(=O)CCC2)C1c1ccc(C#N)cc1C1=CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C33H33F3N4O4/c1-32(2,3)44-31(43)39-15-13-21(14-16-39)25-17-20(19-37)11-12-24(25)29-28-26(9-6-10-27(28)41)40(30(42)38(29)4)23-8-5-7-22(18-23)33(34,35)36/h5,7-8,11-13,17-18,29H,6,9-10,14-16H2,1-4H3 |
| InChIKey | BGPLONMRVDLQEU-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 93.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |