C29H31F3N4O5S — CID 146676539
(4S)-4-[4-cyano-2-[dihydroxy(methyl)-λ4-sulfanyl]phenyl]-N-(2,2-dimethylpropyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide (PubChem CID 146676539) has the molecular formula C29H31F3N4O5S and a molecular weight of 604.65 g/mol. Its IUPAC name is (4S)-4-[4-cyano-2-[dihydroxy(methyl)-λ4-sulfanyl]phenyl]-N-(2,2-dimethylpropyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide.
| Compound Name | (4S)-4-[4-cyano-2-[dihydroxy(methyl)-λ4-sulfanyl]phenyl]-N-(2,2-dimethylpropyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide |
|---|---|
| PubChem CID | 146676539 |
| Molecular Formula | C29H31F3N4O5S |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | (4S)-4-[4-cyano-2-[dihydroxy(methyl)-λ4-sulfanyl]phenyl]-N-(2,2-dimethylpropyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide |
| SMILES | CC(C)(C)CNC(=O)N1C(=O)N(c2cccc(C(F)(F)F)c2)C2=C(C(=O)CCC2)[C@H]1c1ccc(C#N)cc1S(C)(O)O |
| InChI | InChI=1S/C29H31F3N4O5S/c1-28(2,3)16-34-26(38)36-25(20-12-11-17(15-33)13-23(20)42(4,40)41)24-21(9-6-10-22(24)37)35(27(36)39)19-8-5-7-18(14-19)29(30,31)32/h5,7-8,11-14,25,40-41H,6,9-10,16H2,1-4H3,(H,34,38)/t25-/m1/s1 |
| InChIKey | PDCFUSYBMCXOOC-RUZDIDTESA-N |
| XLogP | 7.06 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |