C29H27F3N4O4 — CID 146676525
4-(4-cyanophenyl)-N-[(2S)-2-hydroxycyclohexyl]-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide (PubChem CID 146676525) has the molecular formula C29H27F3N4O4 and a molecular weight of 552.55 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-N-[(2S)-2-hydroxycyclohexyl]-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide.
| Compound Name | 4-(4-cyanophenyl)-N-[(2S)-2-hydroxycyclohexyl]-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide |
|---|---|
| PubChem CID | 146676525 |
| Molecular Formula | C29H27F3N4O4 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 4-(4-cyanophenyl)-N-[(2S)-2-hydroxycyclohexyl]-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide |
| SMILES | N#Cc1ccc(C2C3=C(CCCC3=O)N(c3cccc(C(F)(F)F)c3)C(=O)N2C(=O)NC2CCCC[C@@H]2O)cc1 |
| InChI | InChI=1S/C29H27F3N4O4/c30-29(31,32)19-5-3-6-20(15-19)35-22-8-4-10-24(38)25(22)26(18-13-11-17(16-33)12-14-18)36(28(35)40)27(39)34-21-7-1-2-9-23(21)37/h3,5-6,11-15,21,23,26,37H,1-2,4,7-10H2,(H,34,39)/t21?,23-,26?/m0/s1 |
| InChIKey | QUUCQKJNCFJLTM-JEPVQIMHSA-N |
| XLogP | 5.58 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |