C28H27F3N4O6S — CID 146676538
(4S)-4-[4-cyano-2-[dihydroxy(methyl)-λ4-sulfanyl]phenyl]-N-(3-hydroxycyclobutyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide (PubChem CID 146676538) has the molecular formula C28H27F3N4O6S and a molecular weight of 604.61 g/mol. Its IUPAC name is (4S)-4-[4-cyano-2-[dihydroxy(methyl)-λ4-sulfanyl]phenyl]-N-(3-hydroxycyclobutyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide.
| Compound Name | (4S)-4-[4-cyano-2-[dihydroxy(methyl)-λ4-sulfanyl]phenyl]-N-(3-hydroxycyclobutyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide |
|---|---|
| PubChem CID | 146676538 |
| Molecular Formula | C28H27F3N4O6S |
| Molecular Weight | 604.61 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | (4S)-4-[4-cyano-2-[dihydroxy(methyl)-λ4-sulfanyl]phenyl]-N-(3-hydroxycyclobutyl)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinazoline-3-carboxamide |
| SMILES | CS(O)(O)c1cc(C#N)ccc1[C@@H]1C2=C(CCCC2=O)N(c2cccc(C(F)(F)F)c2)C(=O)N1C(=O)NC1CC(O)C1 |
| InChI | InChI=1S/C28H27F3N4O6S/c1-42(40,41)23-10-15(14-32)8-9-20(23)25-24-21(6-3-7-22(24)37)34(18-5-2-4-16(11-18)28(29,30)31)27(39)35(25)26(38)33-17-12-19(36)13-17/h2,4-5,8-11,17,19,25,36,40-41H,3,6-7,12-13H2,1H3,(H,33,38)/t17?,19?,25-/m1/s1 |
| InChIKey | SLEWLTZXFUJRIS-WKBCRJLYSA-N |
| XLogP | 5.54 |
| TPSA | 154.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |