C32H39N5O3 — CID 118703380
4-[[1-[3-(dimethylamino)propyl]-2,3-dimethylindol-5-yl]amino]-N-(3-hydroxy-4-morpholin-4-ylphenyl)benzamide (PubChem CID 118703380) has the molecular formula C32H39N5O3 and a molecular weight of 541.70 g/mol. Its IUPAC name is 4-[[1-[3-(dimethylamino)propyl]-2,3-dimethylindol-5-yl]amino]-N-(3-hydroxy-4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-[[1-[3-(dimethylamino)propyl]-2,3-dimethylindol-5-yl]amino]-N-(3-hydroxy-4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 118703380 |
| Molecular Formula | C32H39N5O3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | 4-[[1-[3-(dimethylamino)propyl]-2,3-dimethylindol-5-yl]amino]-N-(3-hydroxy-4-morpholin-4-ylphenyl)benzamide |
| SMILES | Cc1c(C)n(CCCN(C)C)c2ccc(Nc3ccc(C(=O)Nc4ccc(N5CCOCC5)c(O)c4)cc3)cc12 |
| InChI | InChI=1S/C32H39N5O3/c1-22-23(2)37(15-5-14-35(3)4)29-12-10-26(20-28(22)29)33-25-8-6-24(7-9-25)32(39)34-27-11-13-30(31(38)21-27)36-16-18-40-19-17-36/h6-13,20-21,33,38H,5,14-19H2,1-4H3,(H,34,39) |
| InChIKey | OLVRQFDSVJBIMY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|