C39H45N5O3 — CID 137163038
N-(3,5-dihydroxy-4-pyridin-4-ylphenyl)-4-[[2,3-dimethyl-1-[5-(4-methylpiperazin-1-yl)pentyl]indol-5-yl]methyl]benzamide (PubChem CID 137163038) has the molecular formula C39H45N5O3 and a molecular weight of 631.82 g/mol. Its IUPAC name is N-(3,5-dihydroxy-4-pyridin-4-ylphenyl)-4-[[2,3-dimethyl-1-[5-(4-methylpiperazin-1-yl)pentyl]indol-5-yl]methyl]benzamide.
| Compound Name | N-(3,5-dihydroxy-4-pyridin-4-ylphenyl)-4-[[2,3-dimethyl-1-[5-(4-methylpiperazin-1-yl)pentyl]indol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 137163038 |
| Molecular Formula | C39H45N5O3 |
| Molecular Weight | 631.82 g/mol |
| Exact Mass | 631.35 |
| IUPAC Name | N-(3,5-dihydroxy-4-pyridin-4-ylphenyl)-4-[[2,3-dimethyl-1-[5-(4-methylpiperazin-1-yl)pentyl]indol-5-yl]methyl]benzamide |
| SMILES | Cc1c(C)n(CCCCCN2CCN(C)CC2)c2ccc(Cc3ccc(C(=O)Nc4cc(O)c(-c5ccncc5)c(O)c4)cc3)cc12 |
| InChI | InChI=1S/C39H45N5O3/c1-27-28(2)44(18-6-4-5-17-43-21-19-42(3)20-22-43)35-12-9-30(24-34(27)35)23-29-7-10-32(11-8-29)39(47)41-33-25-36(45)38(37(46)26-33)31-13-15-40-16-14-31/h7-16,24-26,45-46H,4-6,17-23H2,1-3H3,(H,41,47) |
| InChIKey | RDGWMFCUXDVPAH-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.82 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|