C45H56N2O2 — CID 145192554
N-[3-cyclobutyl-5-hydroxy-4-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]phenyl]-4-[[2,3-dimethyl-1-(5-methylheptyl)indol-5-yl]methyl]benzamide (PubChem CID 145192554) has the molecular formula C45H56N2O2 and a molecular weight of 656.96 g/mol. Its IUPAC name is N-[3-cyclobutyl-5-hydroxy-4-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]phenyl]-4-[[2,3-dimethyl-1-(5-methylheptyl)indol-5-yl]methyl]benzamide.
| Compound Name | N-[3-cyclobutyl-5-hydroxy-4-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]phenyl]-4-[[2,3-dimethyl-1-(5-methylheptyl)indol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 145192554 |
| Molecular Formula | C45H56N2O2 |
| Molecular Weight | 656.96 g/mol |
| Exact Mass | 656.43 |
| IUPAC Name | N-[3-cyclobutyl-5-hydroxy-4-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]phenyl]-4-[[2,3-dimethyl-1-(5-methylheptyl)indol-5-yl]methyl]benzamide |
| SMILES | C/C=C\C(=C/C=C/CC)c1c(O)cc(NC(=O)c2ccc(Cc3ccc4c(c3)c(C)c(C)n4CCCCC(C)CC)cc2)cc1C1CCC1 |
| InChI | InChI=1S/C45H56N2O2/c1-7-10-11-17-37(15-8-2)44-41(36-18-14-19-36)29-39(30-43(44)48)46-45(49)38-23-20-34(21-24-38)27-35-22-25-42-40(28-35)32(5)33(6)47(42)26-13-12-16-31(4)9-3/h8,10-11,15,17,20-25,28-31,36,48H,7,9,12-14,16,18-19,26-27H2,1-6H3,(H,46,49)/b11-10+,15-8-,37-17+ |
| InChIKey | RJUGWHMLKHHDPC-YYTAWZHPSA-N |
| XLogP | 12.22 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.96 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|