C43H53N3O3 — CID 145192375
N-(3,5-dihydroxy-4-phenylphenyl)-4-[[2,3-dimethyl-1-[5-[3-methylbutyl(propyl)amino]pentyl]indol-5-yl]methyl]benzamide (PubChem CID 145192375) has the molecular formula C43H53N3O3 and a molecular weight of 659.92 g/mol. Its IUPAC name is N-(3,5-dihydroxy-4-phenylphenyl)-4-[[2,3-dimethyl-1-[5-[3-methylbutyl(propyl)amino]pentyl]indol-5-yl]methyl]benzamide.
| Compound Name | N-(3,5-dihydroxy-4-phenylphenyl)-4-[[2,3-dimethyl-1-[5-[3-methylbutyl(propyl)amino]pentyl]indol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 145192375 |
| Molecular Formula | C43H53N3O3 |
| Molecular Weight | 659.92 g/mol |
| Exact Mass | 659.41 |
| IUPAC Name | N-(3,5-dihydroxy-4-phenylphenyl)-4-[[2,3-dimethyl-1-[5-[3-methylbutyl(propyl)amino]pentyl]indol-5-yl]methyl]benzamide |
| SMILES | CCCN(CCCCCn1c(C)c(C)c2cc(Cc3ccc(C(=O)Nc4cc(O)c(-c5ccccc5)c(O)c4)cc3)ccc21)CCC(C)C |
| InChI | InChI=1S/C43H53N3O3/c1-6-22-45(25-21-30(2)3)23-11-8-12-24-46-32(5)31(4)38-27-34(17-20-39(38)46)26-33-15-18-36(19-16-33)43(49)44-37-28-40(47)42(41(48)29-37)35-13-9-7-10-14-35/h7,9-10,13-20,27-30,47-48H,6,8,11-12,21-26H2,1-5H3,(H,44,49) |
| InChIKey | FPEIXUXKLUFALN-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.92 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|