C8H7F3N2O2 — CID 118703990
2-[2-amino-6-(trifluoromethyl)-3-pyridinyl]acetic acid (PubChem CID 118703990) has the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. Its IUPAC name is 2-[2-amino-6-(trifluoromethyl)-3-pyridinyl]acetic acid.
| Compound Name | 2-[2-amino-6-(trifluoromethyl)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118703990 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-[2-amino-6-(trifluoromethyl)-3-pyridinyl]acetic acid |
| SMILES | Nc1nc(C(F)(F)F)ccc1CC(=O)O |
| InChI | InChI=1S/C8H7F3N2O2/c9-8(10,11)5-2-1-4(3-6(14)15)7(12)13-5/h1-2H,3H2,(H2,12,13)(H,14,15) |
| InChIKey | HLKMJTZRQGRCFD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |