C12H13ClN2O2 — CID 118705031
(2S)-1-(4-chloro-2-methylphenyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 118705031) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is (2S)-1-(4-chloro-2-methylphenyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(4-chloro-2-methylphenyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118705031 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (2S)-1-(4-chloro-2-methylphenyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | Cc1cc(Cl)ccc1N1C(=O)CC[C@H]1C(N)=O |
| InChI | InChI=1S/C12H13ClN2O2/c1-7-6-8(13)2-3-9(7)15-10(12(14)17)4-5-11(15)16/h2-3,6,10H,4-5H2,1H3,(H2,14,17)/t10-/m0/s1 |
| InChIKey | UXHZPBWILYFZGR-JTQLQIEISA-N |
| XLogP | 1.63 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |