C19H12F3N7O — CID 118706735
N-(1H-indazol-5-yl)-6-[4-(trifluoromethoxy)phenyl]-7H-purin-2-amine (PubChem CID 118706735) has the molecular formula C19H12F3N7O and a molecular weight of 411.35 g/mol. Its IUPAC name is N-(1H-indazol-5-yl)-6-[4-(trifluoromethoxy)phenyl]-7H-purin-2-amine.
| Compound Name | N-(1H-indazol-5-yl)-6-[4-(trifluoromethoxy)phenyl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 118706735 |
| Molecular Formula | C19H12F3N7O |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-(1H-indazol-5-yl)-6-[4-(trifluoromethoxy)phenyl]-7H-purin-2-amine |
| SMILES | FC(F)(F)Oc1ccc(-c2nc(Nc3ccc4[nH]ncc4c3)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C19H12F3N7O/c20-19(21,22)30-13-4-1-10(2-5-13)15-16-17(24-9-23-16)28-18(27-15)26-12-3-6-14-11(7-12)8-25-29-14/h1-9H,(H,25,29)(H2,23,24,26,27,28) |
| InChIKey | HKICHHUOFGPALV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |