C25H36N2O2+2 — CID 11870810
(3S,3aR,8aR,9aR)-5,8a-dimethyl-3-[(4-phenylpiperazine-1,4-diium-1-yl)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 11870810) has the molecular formula C25H36N2O2+2 and a molecular weight of 396.58 g/mol. Its IUPAC name is (3S,3aR,8aR,9aR)-5,8a-dimethyl-3-[(4-phenylpiperazine-1,4-diium-1-yl)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aR,8aR,9aR)-5,8a-dimethyl-3-[(4-phenylpiperazine-1,4-diium-1-yl)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 11870810 |
| Molecular Formula | C25H36N2O2+2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | (3S,3aR,8aR,9aR)-5,8a-dimethyl-3-[(4-phenylpiperazine-1,4-diium-1-yl)methyl]-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=C2C[C@H]3[C@@H](C[C@@]2(C)CCC1)OC(=O)[C@@H]3C[NH+]1CC[NH+](c2ccccc2)CC1 |
| InChI | InChI=1S/C25H34N2O2/c1-18-7-6-10-25(2)16-23-20(15-22(18)25)21(24(28)29-23)17-26-11-13-27(14-12-26)19-8-4-3-5-9-19/h3-5,8-9,20-21,23H,6-7,10-17H2,1-2H3/p+2/t20-,21-,23-,25-/m1/s1 |
| InChIKey | LTZXTCGSLVIUMX-AFFJLAOCSA-P |
| XLogP | 1.56 |
| TPSA | 35.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|