C20H32NO4+ — CID 7078320
[(3R,3aR,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-(1,3-dioxolan-2-ylmethyl)-methylazanium (PubChem CID 7078320) has the molecular formula C20H32NO4+ and a molecular weight of 350.48 g/mol. Its IUPAC name is [(3R,3aR,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-(1,3-dioxolan-2-ylmethyl)-methylazanium.
| Compound Name | [(3R,3aR,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-(1,3-dioxolan-2-ylmethyl)-methylazanium |
|---|---|
| PubChem CID | 7078320 |
| Molecular Formula | C20H32NO4+ |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | [(3R,3aR,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-(1,3-dioxolan-2-ylmethyl)-methylazanium |
| SMILES | CC1=C2C[C@@H]3[C@H](C[NH+](C)CC4OCCO4)C(=O)O[C@@H]3C[C@@]2(C)CCC1 |
| InChI | InChI=1S/C20H31NO4/c1-13-5-4-6-20(2)10-17-14(9-16(13)20)15(19(22)25-17)11-21(3)12-18-23-7-8-24-18/h14-15,17-18H,4-12H2,1-3H3/p+1/t14-,15+,17-,20-/m1/s1 |
| InChIKey | NXXCEAWRSOBYOT-DOHHPOSVSA-O |
| XLogP | 1.33 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|